About 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine
2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine (PubChem CID 168591592) has the molecular formula C15H19N5O2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine |
| PubChem CID | 168591592 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine |
| SMILES | CC(C)CCN1C(=O)c2ccc(C=NN=C(N)N)cc2C1=O |
| InChI | InChI=1S/C15H19N5O2/c1-9(2)5-6-20-13(21)11-4-3-10(7-12(11)14(20)22)8-18-19-15(16)17/h3-4,7-9H,5-6H2,1-2H3,(H4,16,17,19) |
| InChIKey | IHHZVTATFLYQIS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine?
The IUPAC name of 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine (CID 168591592) is 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine.
What is the SMILES notation for 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine?
The canonical SMILES for 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine is CC(C)CCN1C(=O)c2ccc(C=NN=C(N)N)cc2C1=O.
What is the InChIKey of 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine?
The InChIKey is IHHZVTATFLYQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O2/c1-9(2)5-6-20-13(21)11-4-3-10(7-12(11)14(20)22)8-18-19-15(16)17/h3-4,7-9H,5-6H2,1-2H3,(H4,16,17,19).
What are the key properties of 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine?
2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine has a molecular weight of 301.35 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine is sourced from PubChem (CID 168591592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).