C15H19N5O2 — CID 168591592
2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine (PubChem CID 168591592) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine.
| Compound Name | 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591592 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[[2-(3-methylbutyl)-1,3-dioxoisoindol-5-yl]methylideneamino]guanidine |
| SMILES | CC(C)CCN1C(=O)c2ccc(C=NN=C(N)N)cc2C1=O |
| InChI | InChI=1S/C15H19N5O2/c1-9(2)5-6-20-13(21)11-4-3-10(7-12(11)14(20)22)8-18-19-15(16)17/h3-4,7-9H,5-6H2,1-2H3,(H4,16,17,19) |
| InChIKey | IHHZVTATFLYQIS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|