C14H21FN2O3 — CID 168595759
3-[2-fluoro-6-(4-hydroxypiperidin-1-yl)anilino]propane-1,2-diol (PubChem CID 168595759) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-[2-fluoro-6-(4-hydroxypiperidin-1-yl)anilino]propane-1,2-diol.
| Compound Name | 3-[2-fluoro-6-(4-hydroxypiperidin-1-yl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168595759 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-[2-fluoro-6-(4-hydroxypiperidin-1-yl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1c(F)cccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C14H21FN2O3/c15-12-2-1-3-13(14(12)16-8-11(20)9-18)17-6-4-10(19)5-7-17/h1-3,10-11,16,18-20H,4-9H2 |
| InChIKey | PFKNURSATLBQBH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |