C11H15FN2O3 — CID 168595257
2-(2,3-dihydroxypropylamino)-3-fluoro-N-methylbenzamide (PubChem CID 168595257) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-3-fluoro-N-methylbenzamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-3-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 168595257 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-3-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(F)c1NCC(O)CO |
| InChI | InChI=1S/C11H15FN2O3/c1-13-11(17)8-3-2-4-9(12)10(8)14-5-7(16)6-15/h2-4,7,14-16H,5-6H2,1H3,(H,13,17) |
| InChIKey | VMVLWPDYDOONGB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |