C10H13BrClNO3 — CID 168597233
3-(3-bromo-5-chloro-4-methoxyanilino)propane-1,2-diol (PubChem CID 168597233) has the molecular formula C10H13BrClNO3 and a molecular weight of 310.58 g/mol. Its IUPAC name is 3-(3-bromo-5-chloro-4-methoxyanilino)propane-1,2-diol.
| Compound Name | 3-(3-bromo-5-chloro-4-methoxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168597233 |
| Molecular Formula | C10H13BrClNO3 |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 3-(3-bromo-5-chloro-4-methoxyanilino)propane-1,2-diol |
| SMILES | COc1c(Cl)cc(NCC(O)CO)cc1Br |
| InChI | InChI=1S/C10H13BrClNO3/c1-16-10-8(11)2-6(3-9(10)12)13-4-7(15)5-14/h2-3,7,13-15H,4-5H2,1H3 |
| InChIKey | WVZKWLQVZQJAPH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|