C13H9ClF2O4 — CID 168598285
5-[(3-chloro-4,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168598285) has the molecular formula C13H9ClF2O4 and a molecular weight of 302.66 g/mol. Its IUPAC name is 5-[(3-chloro-4,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3-chloro-4,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598285 |
| Molecular Formula | C13H9ClF2O4 |
| Molecular Weight | 302.66 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5-[(3-chloro-4,5-difluorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2cc(F)c(F)c(Cl)c2)C(=O)O1 |
| InChI | InChI=1S/C13H9ClF2O4/c1-13(2)19-11(17)7(12(18)20-13)3-6-4-8(14)10(16)9(15)5-6/h3-5H,1-2H3 |
| InChIKey | HHNKJQLGLQMZSI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|