C19H13F3N2O6S — CID 168598561
2,2-dimethyl-5-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168598561) has the molecular formula C19H13F3N2O6S and a molecular weight of 454.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598561 |
| Molecular Formula | C19H13F3N2O6S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 2,2-dimethyl-5-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2cc([N+](=O)[O-])ccc2Sc2ccc(C(F)(F)F)cn2)C(=O)O1 |
| InChI | InChI=1S/C19H13F3N2O6S/c1-18(2)29-16(25)13(17(26)30-18)8-10-7-12(24(27)28)4-5-14(10)31-15-6-3-11(9-23-15)19(20,21)22/h3-9H,1-2H3 |
| InChIKey | FDIMXFSZCIIGHK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|