C17H12F3N5O2S2 — CID 168619578
4-methyl-N-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168619578) has the molecular formula C17H12F3N5O2S2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 4-methyl-N-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619578 |
| Molecular Formula | C17H12F3N5O2S2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-methyl-N-[[5-nitro-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2cc([N+](=O)[O-])ccc2Sc2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C17H12F3N5O2S2/c1-10-9-28-16(23-10)24-22-7-11-6-13(25(26)27)3-4-14(11)29-15-5-2-12(8-21-15)17(18,19)20/h2-9H,1H3,(H,23,24) |
| InChIKey | XREINHCNQKHDJP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|