C13H19N5O2 — CID 168602437
1-(diaminomethylidene)-2-[2-(oxolan-2-ylmethoxy)phenyl]guanidine (PubChem CID 168602437) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(oxolan-2-ylmethoxy)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(oxolan-2-ylmethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 168602437 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(oxolan-2-ylmethoxy)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C13H19N5O2/c14-12(15)18-13(16)17-10-5-1-2-6-11(10)20-8-9-4-3-7-19-9/h1-2,5-6,9H,3-4,7-8H2,(H6,14,15,16,17,18) |
| InChIKey | HKNZSRXENCPZOP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|