C10H11N7O2 — CID 168602987
5-[[amino-(diaminomethylideneamino)methylidene]amino]-1H-indazole-7-carboxylic acid (PubChem CID 168602987) has the molecular formula C10H11N7O2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 5-[[amino-(diaminomethylideneamino)methylidene]amino]-1H-indazole-7-carboxylic acid.
| Compound Name | 5-[[amino-(diaminomethylideneamino)methylidene]amino]-1H-indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 168602987 |
| Molecular Formula | C10H11N7O2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 5-[[amino-(diaminomethylideneamino)methylidene]amino]-1H-indazole-7-carboxylic acid |
| SMILES | NC(N)=N/C(N)=N/c1cc(C(=O)O)c2[nH]ncc2c1 |
| InChI | InChI=1S/C10H11N7O2/c11-9(12)16-10(13)15-5-1-4-3-14-17-7(4)6(2-5)8(18)19/h1-3H,(H,14,17)(H,18,19)(H6,11,12,13,15,16) |
| InChIKey | KDTVSCHHBPVKTF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 168.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|