C11H14N6O2S — CID 168604389
2-[4-(2-cyanoethylsulfonyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168604389) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[4-(2-cyanoethylsulfonyl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[4-(2-cyanoethylsulfonyl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604389 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[4-(2-cyanoethylsulfonyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | N#CCCS(=O)(=O)c1ccc(/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C11H14N6O2S/c12-6-1-7-20(18,19)9-4-2-8(3-5-9)16-11(15)17-10(13)14/h2-5H,1,7H2,(H6,13,14,15,16,17) |
| InChIKey | HUZKYHSNLFQWQI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|