C12H15N7O2 — CID 168605462
1-(diaminomethylidene)-2-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]guanidine (PubChem CID 168605462) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168605462 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]guanidine |
| SMILES | CC1NC(=O)N(c2cccc(/N=C(\N)N=C(N)N)c2)C1=O |
| InChI | InChI=1S/C12H15N7O2/c1-6-9(20)19(12(21)16-6)8-4-2-3-7(5-8)17-11(15)18-10(13)14/h2-6H,1H3,(H,16,21)(H6,13,14,15,17,18) |
| InChIKey | RGUZAQSZINSIPN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|