C11H14N6O2 — CID 168603317
1-(diaminomethylidene)-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]guanidine (PubChem CID 168603317) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168603317 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C11H14N6O2/c12-9(13)16-10(14)15-7-2-1-3-8(6-7)17-4-5-19-11(17)18/h1-3,6H,4-5H2,(H6,12,13,14,15,16) |
| InChIKey | PSYNXQGBNKLXMD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|