C19H13N7 — CID 168607155
2-[[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607155) has the molecular formula C19H13N7 and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607155 |
| Molecular Formula | C19H13N7 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]amino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1cc(C)n(-c2ccc3cccc(NC(C#N)=C(C#N)C#N)c3n2)n1 |
| InChI | InChI=1S/C19H13N7/c1-12-8-13(2)26(25-12)18-7-6-14-4-3-5-16(19(14)24-18)23-17(11-22)15(9-20)10-21/h3-8,23H,1-2H3 |
| InChIKey | RSARXAIFUBWPIS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|