C16H16ClN5 — CID 169366091
2-chloro-N'-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]ethanimidamide (PubChem CID 169366091) has the molecular formula C16H16ClN5 and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-chloro-N'-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]ethanimidamide |
|---|---|
| PubChem CID | 169366091 |
| Molecular Formula | C16H16ClN5 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-chloro-N'-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]ethanimidamide |
| SMILES | Cc1cc(C)n(-c2ccc3cccc(/N=C(/N)CCl)c3n2)n1 |
| InChI | InChI=1S/C16H16ClN5/c1-10-8-11(2)22(21-10)15-7-6-12-4-3-5-13(16(12)20-15)19-14(18)9-17/h3-8H,9H2,1-2H3,(H2,18,19) |
| InChIKey | URJKFQRSDNZPHA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|