C15H12N6O3 — CID 168608510
2-(5-morpholin-4-yl-2-nitroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168608510) has the molecular formula C15H12N6O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-(5-morpholin-4-yl-2-nitroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(5-morpholin-4-yl-2-nitroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608510 |
| Molecular Formula | C15H12N6O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(5-morpholin-4-yl-2-nitroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(N2CCOCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N6O3/c16-8-11(9-17)14(10-18)19-13-7-12(1-2-15(13)21(22)23)20-3-5-24-6-4-20/h1-2,7,19H,3-6H2 |
| InChIKey | RFIDXOSIOLGCNM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|