C19H25N3O4S — CID 168620166
2-[2-[[2,6-dimethyl-4-(3-methylbutoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620166) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[2-[[2,6-dimethyl-4-(3-methylbutoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[2,6-dimethyl-4-(3-methylbutoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620166 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[2-[[2,6-dimethyl-4-(3-methylbutoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1cc(OCCC(C)C)cc(C)c1C=NN=C1NC(=O)C(CC(=O)O)S1 |
| InChI | InChI=1S/C19H25N3O4S/c1-11(2)5-6-26-14-7-12(3)15(13(4)8-14)10-20-22-19-21-18(25)16(27-19)9-17(23)24/h7-8,10-11,16H,5-6,9H2,1-4H3,(H,23,24)(H,21,22,25) |
| InChIKey | DZAISYWTTTVOHO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|