C23H24N4O7S — CID 168621301
2-[2-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621301) has the molecular formula C23H24N4O7S and a molecular weight of 500.53 g/mol. Its IUPAC name is 2-[2-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621301 |
| Molecular Formula | C23H24N4O7S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-[2-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(C=NN=C3NC(=O)C(CC(=O)O)S3)cc2OC)cc1 |
| InChI | InChI=1S/C23H24N4O7S/c1-3-33-16-7-5-15(6-8-16)25-20(28)13-34-17-9-4-14(10-18(17)32-2)12-24-27-23-26-22(31)19(35-23)11-21(29)30/h4-10,12,19H,3,11,13H2,1-2H3,(H,25,28)(H,29,30)(H,26,27,31) |
| InChIKey | CDQDICDINLFZNY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|