C22H21ClN4O6S — CID 168621799
2-[2-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621799) has the molecular formula C22H21ClN4O6S and a molecular weight of 504.95 g/mol. Its IUPAC name is 2-[2-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621799 |
| Molecular Formula | C22H21ClN4O6S |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 2-[2-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN4O6S/c1-2-32-17-9-13(11-24-27-22-26-21(31)18(34-22)10-20(29)30)7-8-16(17)33-12-19(28)25-15-6-4-3-5-14(15)23/h3-9,11,18H,2,10,12H2,1H3,(H,25,28)(H,29,30)(H,26,27,31) |
| InChIKey | FLESQGXGKALCLB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|