C13H8F2N4O3S — CID 168621539
2-[2-[(3-cyano-2,6-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621539) has the molecular formula C13H8F2N4O3S and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-[2-[(3-cyano-2,6-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(3-cyano-2,6-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621539 |
| Molecular Formula | C13H8F2N4O3S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[2-[(3-cyano-2,6-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | N#Cc1ccc(F)c(C=NN=C2NC(=O)C(CC(=O)O)S2)c1F |
| InChI | InChI=1S/C13H8F2N4O3S/c14-8-2-1-6(4-16)11(15)7(8)5-17-19-13-18-12(22)9(23-13)3-10(20)21/h1-2,5,9H,3H2,(H,20,21)(H,18,19,22) |
| InChIKey | HHTWLCOYBNJSSX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|