C22H22F3N5O2S — CID 168624116
ethyl 2-[2-[2-[[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624116) has the molecular formula C22H22F3N5O2S and a molecular weight of 477.51 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624116 |
| Molecular Formula | C22H22F3N5O2S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | ethyl 2-[2-[2-[[4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(-c3cc(C(F)(F)F)cc(N(C)C)n3)cc2)n1 |
| InChI | InChI=1S/C22H22F3N5O2S/c1-4-32-20(31)11-17-13-33-21(27-17)29-26-12-14-5-7-15(8-6-14)18-9-16(22(23,24)25)10-19(28-18)30(2)3/h5-10,12-13H,4,11H2,1-3H3,(H,27,29) |
| InChIKey | ZFVZRLNAOQQDOD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|