C21H21N3O5S2 — CID 168624328
[2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 168624328) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is [2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 168624328 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OC(=O)c3cccs3)c(OCC)c2)n1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-3-27-17-10-14(7-8-16(17)29-20(26)18-6-5-9-30-18)12-22-24-21-23-15(13-31-21)11-19(25)28-4-2/h5-10,12-13H,3-4,11H2,1-2H3,(H,23,24) |
| InChIKey | YVGPDWJDTKVQCS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|