C26H30N4O6S — CID 168624713
ethyl 2-[2-[2-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624713) has the molecular formula C26H30N4O6S and a molecular weight of 526.62 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624713 |
| Molecular Formula | C26H30N4O6S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | ethyl 2-[2-[2-[[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OCC(=O)Nc3ccc(OCC)cc3)c(OCC)c2)n1 |
| InChI | InChI=1S/C26H30N4O6S/c1-4-33-21-10-8-19(9-11-21)28-24(31)16-36-22-12-7-18(13-23(22)34-5-2)15-27-30-26-29-20(17-37-26)14-25(32)35-6-3/h7-13,15,17H,4-6,14,16H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | BPAQVRUSDRRXNC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|