C17H22FN5S — CID 168626264
2-N-[[4-fluoro-2-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626264) has the molecular formula C17H22FN5S and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-N-[[4-fluoro-2-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-fluoro-2-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626264 |
| Molecular Formula | C17H22FN5S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-N-[[4-fluoro-2-[(4-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CC1CCN(Cc2cc(F)ccc2C=NNc2nc(N)cs2)CC1 |
| InChI | InChI=1S/C17H22FN5S/c1-12-4-6-23(7-5-12)10-14-8-15(18)3-2-13(14)9-20-22-17-21-16(19)11-24-17/h2-3,8-9,11-12H,4-7,10,19H2,1H3,(H,21,22) |
| InChIKey | UZDPPHKKHKNGSK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|