C17H18N4O2S2 — CID 168626333
2-N-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626333) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-N-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626333 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-N-[[3-(furan-2-ylmethylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1ccc(C=NNc2nc(N)cs2)cc1CSCc1ccco1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-22-15-5-4-12(8-19-21-17-20-16(18)11-25-17)7-13(15)9-24-10-14-3-2-6-23-14/h2-8,11H,9-10,18H2,1H3,(H,20,21) |
| InChIKey | TXFBRFWFWAJUDY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|