C18H15BrCl2N4O — CID 168630234
1-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168630234) has the molecular formula C18H15BrCl2N4O and a molecular weight of 454.16 g/mol. Its IUPAC name is 1-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168630234 |
| Molecular Formula | C18H15BrCl2N4O |
| Molecular Weight | 454.16 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 1-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)c(N)n1 |
| InChI | InChI=1S/C18H15BrCl2N4O/c1-11-9-25(18(22)24-11)23-8-13-6-14(19)3-5-17(13)26-10-12-2-4-15(20)7-16(12)21/h2-9H,10H2,1H3,(H2,22,24) |
| InChIKey | LYUUWBBCVOQVMD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.16 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|