C17H24N4 — CID 168630428
4-methyl-1-[(2,4,6-triethylphenyl)methylideneamino]imidazol-2-amine (PubChem CID 168630428) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-methyl-1-[(2,4,6-triethylphenyl)methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[(2,4,6-triethylphenyl)methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168630428 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-methyl-1-[(2,4,6-triethylphenyl)methylideneamino]imidazol-2-amine |
| SMILES | CCc1cc(CC)c(C=Nn2cc(C)nc2N)c(CC)c1 |
| InChI | InChI=1S/C17H24N4/c1-5-13-8-14(6-2)16(15(7-3)9-13)10-19-21-11-12(4)20-17(21)18/h8-11H,5-7H2,1-4H3,(H2,18,20) |
| InChIKey | PASLYJXREIPOCT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|