C16H19NO9S — CID 168631425
4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-5-methoxy-2-methylbenzenesulfonic acid (PubChem CID 168631425) has the molecular formula C16H19NO9S and a molecular weight of 401.39 g/mol. Its IUPAC name is 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-5-methoxy-2-methylbenzenesulfonic acid.
| Compound Name | 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-5-methoxy-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 168631425 |
| Molecular Formula | C16H19NO9S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-5-methoxy-2-methylbenzenesulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C)c(S(=O)(=O)O)cc2OC)COC1 |
| InChI | InChI=1S/C16H19NO9S/c1-9-5-11(12(23-2)6-13(9)27(20,21)22)17-8-26-7-10(15(18)24-3)14(17)16(19)25-4/h5-6H,7-8H2,1-4H3,(H,20,21,22) |
| InChIKey | RNNZGPGHWGSACP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|