C18H17NO8S — CID 168636225
8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]naphthalene-1-sulfonic acid (PubChem CID 168636225) has the molecular formula C18H17NO8S and a molecular weight of 407.40 g/mol. Its IUPAC name is 8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]naphthalene-1-sulfonic acid.
| Compound Name | 8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 168636225 |
| Molecular Formula | C18H17NO8S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 8-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]naphthalene-1-sulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc3cccc(S(=O)(=O)O)c23)COC1 |
| InChI | InChI=1S/C18H17NO8S/c1-25-17(20)12-9-27-10-19(16(12)18(21)26-2)13-7-3-5-11-6-4-8-14(15(11)13)28(22,23)24/h3-8H,9-10H2,1-2H3,(H,22,23,24) |
| InChIKey | YTXRFFFNJXQTRI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|