C17H17ClF2N2O2S — CID 168637370
2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfanyl-N-(2,5-difluorophenyl)acetamide (PubChem CID 168637370) has the molecular formula C17H17ClF2N2O2S and a molecular weight of 386.85 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfanyl-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfanyl-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 168637370 |
| Molecular Formula | C17H17ClF2N2O2S |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]sulfanyl-N-(2,5-difluorophenyl)acetamide |
| SMILES | O=C(CSc1ccc(NCC(O)CCl)cc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C17H17ClF2N2O2S/c18-8-13(23)9-21-12-2-4-14(5-3-12)25-10-17(24)22-16-7-11(19)1-6-15(16)20/h1-7,13,21,23H,8-10H2,(H,22,24) |
| InChIKey | YDKYFAGVOGAGTR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|