C21H33N3O4S — CID 16863833
N,N-dibutyl-4-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)benzenesulfonamide (PubChem CID 16863833) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is N,N-dibutyl-4-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)benzenesulfonamide.
| Compound Name | N,N-dibutyl-4-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 16863833 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N,N-dibutyl-4-(2,2-dimethyl-3-oxopiperazine-1-carbonyl)benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)N2CCNC(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C21H33N3O4S/c1-5-7-14-23(15-8-6-2)29(27,28)18-11-9-17(10-12-18)19(25)24-16-13-22-20(26)21(24,3)4/h9-12H,5-8,13-16H2,1-4H3,(H,22,26) |
| InChIKey | HTHLPXAEXDSCEX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |