C20H19ClN2O3 — CID 168639210
2-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]-6-methylquinoline-4-carboxylic acid (PubChem CID 168639210) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]-6-methylquinoline-4-carboxylic acid.
| Compound Name | 2-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]-6-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168639210 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[3-[(3-chloro-2-hydroxypropyl)amino]phenyl]-6-methylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3cccc(NCC(O)CCl)c3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-12-5-6-18-16(7-12)17(20(25)26)9-19(23-18)13-3-2-4-14(8-13)22-11-15(24)10-21/h2-9,15,22,24H,10-11H2,1H3,(H,25,26) |
| InChIKey | BIEVINYJJDEVLY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|