C10H11ClFNO4 — CID 168640204
3-[(3-chloro-2-hydroxypropyl)amino]-6-fluoro-2-hydroxybenzoic acid (PubChem CID 168640204) has the molecular formula C10H11ClFNO4 and a molecular weight of 263.65 g/mol. Its IUPAC name is 3-[(3-chloro-2-hydroxypropyl)amino]-6-fluoro-2-hydroxybenzoic acid.
| Compound Name | 3-[(3-chloro-2-hydroxypropyl)amino]-6-fluoro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168640204 |
| Molecular Formula | C10H11ClFNO4 |
| Molecular Weight | 263.65 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-[(3-chloro-2-hydroxypropyl)amino]-6-fluoro-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(F)ccc(NCC(O)CCl)c1O |
| InChI | InChI=1S/C10H11ClFNO4/c11-3-5(14)4-13-7-2-1-6(12)8(9(7)15)10(16)17/h1-2,5,13-15H,3-4H2,(H,16,17) |
| InChIKey | BQSSMYXIGNPKKA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.65 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|