C25H23N3O7 — CID 168641452
dimethyl 6-amino-5-cyano-1-(4-methoxy-2-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168641452) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(4-methoxy-2-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(4-methoxy-2-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168641452 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(4-methoxy-2-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(OC)cc2C(=O)OC)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C25H23N3O7/c1-32-15-10-11-18(16(12-15)23(29)33-2)28-21(25(31)35-4)20(24(30)34-3)19(17(13-26)22(28)27)14-8-6-5-7-9-14/h5-12,19H,27H2,1-4H3 |
| InChIKey | QLIVVIDRIWZCLA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|