C25H22FN3O7 — CID 168643964
dimethyl 6-amino-5-cyano-1-(4-fluoro-2-methoxy-3-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643964) has the molecular formula C25H22FN3O7 and a molecular weight of 495.46 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(4-fluoro-2-methoxy-3-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(4-fluoro-2-methoxy-3-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643964 |
| Molecular Formula | C25H22FN3O7 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(4-fluoro-2-methoxy-3-methoxycarbonylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(F)c(C(=O)OC)c2OC)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C25H22FN3O7/c1-33-21-16(11-10-15(26)18(21)23(30)34-2)29-20(25(32)36-4)19(24(31)35-3)17(14(12-27)22(29)28)13-8-6-5-7-9-13/h5-11,17H,28H2,1-4H3 |
| InChIKey | ZXTHFOJCQLIUQR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|