C33H32N4O6 — CID 168643380
dimethyl 6-amino-5-cyano-1-[2-[2-(3,4-dimethylphenoxy)ethylcarbamoyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643380) has the molecular formula C33H32N4O6 and a molecular weight of 580.64 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[2-[2-(3,4-dimethylphenoxy)ethylcarbamoyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[2-[2-(3,4-dimethylphenoxy)ethylcarbamoyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643380 |
| Molecular Formula | C33H32N4O6 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[2-[2-(3,4-dimethylphenoxy)ethylcarbamoyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(=O)NCCOc2ccc(C)c(C)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C33H32N4O6/c1-20-14-15-23(18-21(20)2)43-17-16-36-31(38)24-12-8-9-13-26(24)37-29(33(40)42-4)28(32(39)41-3)27(25(19-34)30(37)35)22-10-6-5-7-11-22/h5-15,18,27H,16-17,35H2,1-4H3,(H,36,38) |
| InChIKey | UJAFTETZPDMLHF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|