C26H24F3N3O6 — CID 168643881
dimethyl 6-amino-5-cyano-1-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643881) has the molecular formula C26H24F3N3O6 and a molecular weight of 531.49 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643881 |
| Molecular Formula | C26H24F3N3O6 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COCCOc1cc(N2C(N)=C(C#N)C(c3ccccc3)C(C(=O)OC)=C2C(=O)OC)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H24F3N3O6/c1-35-9-10-38-18-12-16(26(27,28)29)11-17(13-18)32-22(25(34)37-3)21(24(33)36-2)20(19(14-30)23(32)31)15-7-5-4-6-8-15/h4-8,11-13,20H,9-10,31H2,1-3H3 |
| InChIKey | IYWZCFBYERXYII-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|