C29H21F3N4O7 — CID 168644375
dimethyl 6-amino-5-cyano-1-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644375) has the molecular formula C29H21F3N4O7 and a molecular weight of 594.50 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644375 |
| Molecular Formula | C29H21F3N4O7 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Oc3cccc(C(F)(F)F)c3)cc([N+](=O)[O-])c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C29H21F3N4O7/c1-41-27(37)24-23(16-7-4-3-5-8-16)22(15-33)26(34)35(25(24)28(38)42-2)18-12-19(36(39)40)14-21(13-18)43-20-10-6-9-17(11-20)29(30,31)32/h3-14,23H,34H2,1-2H3 |
| InChIKey | FMCKOIOOIFOSRW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|