C27H21N5O6S — CID 168643290
dimethyl 6-amino-5-cyano-1-(3-nitro-5-pyridin-2-ylsulfanylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643290) has the molecular formula C27H21N5O6S and a molecular weight of 543.56 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-(3-nitro-5-pyridin-2-ylsulfanylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-(3-nitro-5-pyridin-2-ylsulfanylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643290 |
| Molecular Formula | C27H21N5O6S |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-(3-nitro-5-pyridin-2-ylsulfanylphenyl)-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Sc3ccccn3)cc([N+](=O)[O-])c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C27H21N5O6S/c1-37-26(33)23-22(16-8-4-3-5-9-16)20(15-28)25(29)31(24(23)27(34)38-2)17-12-18(32(35)36)14-19(13-17)39-21-10-6-7-11-30-21/h3-14,22H,29H2,1-2H3 |
| InChIKey | ORZZUKKJMSXDHX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|