C31H23N5O6S — CID 168642675
dimethyl 6-amino-5-cyano-1-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168642675) has the molecular formula C31H23N5O6S and a molecular weight of 593.62 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168642675 |
| Molecular Formula | C31H23N5O6S |
| Molecular Weight | 593.62 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc([N+](=O)[O-])cc2-c2nc(-c3ccccc3)cs2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C31H23N5O6S/c1-41-30(37)26-25(19-11-7-4-8-12-19)22(16-32)28(33)35(27(26)31(38)42-2)24-14-13-20(36(39)40)15-21(24)29-34-23(17-43-29)18-9-5-3-6-10-18/h3-15,17,25H,33H2,1-2H3 |
| InChIKey | KAHLZNCEQGLEGR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|