C32H25N5O7S — CID 168644039
dimethyl 6-amino-5-cyano-1-[3-[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644039) has the molecular formula C32H25N5O7S and a molecular weight of 623.65 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[3-[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[3-[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644039 |
| Molecular Formula | C32H25N5O7S |
| Molecular Weight | 623.65 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[3-[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(-c3nc(-c4ccc(OC)c([N+](=O)[O-])c4)cs3)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C32H25N5O7S/c1-42-25-13-12-19(15-24(25)37(40)41)23-17-45-30(35-23)20-10-7-11-21(14-20)36-28(32(39)44-3)27(31(38)43-2)26(22(16-33)29(36)34)18-8-5-4-6-9-18/h4-15,17,26H,34H2,1-3H3 |
| InChIKey | TUYZLNMGVMIBBC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 170.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|