C26H21ClN4O4 — CID 168643616
dimethyl 6-amino-1-(2-chloro-4-methylquinolin-7-yl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643616) has the molecular formula C26H21ClN4O4 and a molecular weight of 488.93 g/mol. Its IUPAC name is dimethyl 6-amino-1-(2-chloro-4-methylquinolin-7-yl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-(2-chloro-4-methylquinolin-7-yl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643616 |
| Molecular Formula | C26H21ClN4O4 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | dimethyl 6-amino-1-(2-chloro-4-methylquinolin-7-yl)-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(C)cc(Cl)nc3c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C26H21ClN4O4/c1-14-11-20(27)30-19-12-16(9-10-17(14)19)31-23(26(33)35-3)22(25(32)34-2)21(18(13-28)24(31)29)15-7-5-4-6-8-15/h4-12,21H,29H2,1-3H3 |
| InChIKey | VNXSJXXMEHVBNR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|