C35H30N4O8 — CID 168644210
dimethyl 6-amino-5-cyano-1-[4-[2-(1,3-dioxoisoindol-2-yl)-3-ethoxy-3-oxopropyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644210) has the molecular formula C35H30N4O8 and a molecular weight of 634.65 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[4-[2-(1,3-dioxoisoindol-2-yl)-3-ethoxy-3-oxopropyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[4-[2-(1,3-dioxoisoindol-2-yl)-3-ethoxy-3-oxopropyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644210 |
| Molecular Formula | C35H30N4O8 |
| Molecular Weight | 634.65 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[4-[2-(1,3-dioxoisoindol-2-yl)-3-ethoxy-3-oxopropyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C(Cc1ccc(N2C(N)=C(C#N)C(c3ccccc3)C(C(=O)OC)=C2C(=O)OC)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H30N4O8/c1-4-47-33(42)26(39-31(40)23-12-8-9-13-24(23)32(39)41)18-20-14-16-22(17-15-20)38-29(35(44)46-3)28(34(43)45-2)27(25(19-36)30(38)37)21-10-6-5-7-11-21/h5-17,26-27H,4,18,37H2,1-3H3 |
| InChIKey | RHSLIHIGEATQTB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 169.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|