C24H21BrN2O7 — CID 168647674
dimethyl 1-[2-bromo-4-[(4-methoxyphenyl)methyl]-6-nitrophenyl]azepine-2,3-dicarboxylate (PubChem CID 168647674) has the molecular formula C24H21BrN2O7 and a molecular weight of 529.34 g/mol. Its IUPAC name is dimethyl 1-[2-bromo-4-[(4-methoxyphenyl)methyl]-6-nitrophenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-bromo-4-[(4-methoxyphenyl)methyl]-6-nitrophenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647674 |
| Molecular Formula | C24H21BrN2O7 |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | dimethyl 1-[2-bromo-4-[(4-methoxyphenyl)methyl]-6-nitrophenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Br)cc(Cc3ccc(OC)cc3)cc2[N+](=O)[O-])C=CC=C1 |
| InChI | InChI=1S/C24H21BrN2O7/c1-32-17-9-7-15(8-10-17)12-16-13-19(25)22(20(14-16)27(30)31)26-11-5-4-6-18(23(28)33-2)21(26)24(29)34-3/h4-11,13-14H,12H2,1-3H3 |
| InChIKey | RNQCAJJJGIIRIT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|