C20H20N2O6 — CID 168649537
dimethyl 1-(2-methoxycarbonyl-2,3-dihydro-1H-indol-6-yl)azepine-2,3-dicarboxylate (PubChem CID 168649537) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is dimethyl 1-(2-methoxycarbonyl-2,3-dihydro-1H-indol-6-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-methoxycarbonyl-2,3-dihydro-1H-indol-6-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649537 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | dimethyl 1-(2-methoxycarbonyl-2,3-dihydro-1H-indol-6-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)NC(C(=O)OC)C3)C=CC=C1 |
| InChI | InChI=1S/C20H20N2O6/c1-26-18(23)14-6-4-5-9-22(17(14)20(25)28-3)13-8-7-12-10-16(19(24)27-2)21-15(12)11-13/h4-9,11,16,21H,10H2,1-3H3 |
| InChIKey | OOYAQYITIRKXEO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|