C12H15N3O2 — CID 168652422
N-[2-(3-hydroxybutyl)-3H-benzimidazol-5-yl]formamide (PubChem CID 168652422) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[2-(3-hydroxybutyl)-3H-benzimidazol-5-yl]formamide.
| Compound Name | N-[2-(3-hydroxybutyl)-3H-benzimidazol-5-yl]formamide |
|---|---|
| PubChem CID | 168652422 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[2-(3-hydroxybutyl)-3H-benzimidazol-5-yl]formamide |
| SMILES | CC(O)CCc1nc2ccc(NC=O)cc2[nH]1 |
| InChI | InChI=1S/C12H15N3O2/c1-8(17)2-5-12-14-10-4-3-9(13-7-16)6-11(10)15-12/h3-4,6-8,17H,2,5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | GEHUQVHUIZSORB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|