C10H9N3O2 — CID 168654344
N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide (PubChem CID 168654344) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide.
| Compound Name | N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide |
|---|---|
| PubChem CID | 168654344 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide |
| SMILES | O=CNc1ccc(C2=NNC(=O)C2)cc1 |
| InChI | InChI=1S/C10H9N3O2/c14-6-11-8-3-1-7(2-4-8)9-5-10(15)13-12-9/h1-4,6H,5H2,(H,11,14)(H,13,15) |
| InChIKey | AMLWFJOOIWOGPO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|