About N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide
N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide (PubChem CID 168654344) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide.
Molecular Properties
| Compound Name | N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide |
| PubChem CID | 168654344 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide |
| SMILES | O=CNc1ccc(C2=NNC(=O)C2)cc1 |
| InChI | InChI=1S/C10H9N3O2/c14-6-11-8-3-1-7(2-4-8)9-5-10(15)13-12-9/h1-4,6H,5H2,(H,11,14)(H,13,15) |
| InChIKey | AMLWFJOOIWOGPO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide?
The IUPAC name of N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide (CID 168654344) is N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide.
What is the SMILES notation for N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide?
The canonical SMILES for N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide is O=CNc1ccc(C2=NNC(=O)C2)cc1.
What is the InChIKey of N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide?
The InChIKey is AMLWFJOOIWOGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c14-6-11-8-3-1-7(2-4-8)9-5-10(15)13-12-9/h1-4,6H,5H2,(H,11,14)(H,13,15).
What are the key properties of N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide?
N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide has a molecular weight of 203.20 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5-oxo-1,4-dihydropyrazol-3-yl)phenyl]formamide is sourced from PubChem (CID 168654344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).