C13H11N5O3 — CID 142182880
N-[4-(3-amino-4,6-dioxo-7H-pyrazolo[4,3-c]pyridin-2-yl)phenyl]formamide (PubChem CID 142182880) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is N-[4-(3-amino-4,6-dioxo-7H-pyrazolo[4,3-c]pyridin-2-yl)phenyl]formamide.
| Compound Name | N-[4-(3-amino-4,6-dioxo-7H-pyrazolo[4,3-c]pyridin-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 142182880 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[4-(3-amino-4,6-dioxo-7H-pyrazolo[4,3-c]pyridin-2-yl)phenyl]formamide |
| SMILES | Nc1c2c(nn1-c1ccc(NC=O)cc1)CC(=O)NC2=O |
| InChI | InChI=1S/C13H11N5O3/c14-12-11-9(5-10(20)16-13(11)21)17-18(12)8-3-1-7(2-4-8)15-6-19/h1-4,6H,5,14H2,(H,15,19)(H,16,20,21) |
| InChIKey | HOPVUTXYHPIVTG-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|