C13H11N5O3 — CID 91612887
3-amino-7-methoxyimino-2-phenylpyrazolo[4,3-c]pyridine-4,6-dione (PubChem CID 91612887) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-amino-7-methoxyimino-2-phenylpyrazolo[4,3-c]pyridine-4,6-dione.
| Compound Name | 3-amino-7-methoxyimino-2-phenylpyrazolo[4,3-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 91612887 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-amino-7-methoxyimino-2-phenylpyrazolo[4,3-c]pyridine-4,6-dione |
| SMILES | CON=C1C(=O)NC(=O)c2c1nn(-c1ccccc1)c2N |
| InChI | InChI=1S/C13H11N5O3/c1-21-17-10-9-8(12(19)15-13(10)20)11(14)18(16-9)7-5-3-2-4-6-7/h2-6H,14H2,1H3,(H,15,19,20) |
| InChIKey | LUDWLNDWJGCKTH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|