C16H19NO3S — CID 168665805
S-[[1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168665805) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is S-[[1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168665805 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | S-[[1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(C2c3ccccc3CC2O)C1 |
| InChI | InChI=1S/C16H19NO3S/c1-10(18)21-9-11-6-15(20)17(8-11)16-13-5-3-2-4-12(13)7-14(16)19/h2-5,11,14,16,19H,6-9H2,1H3 |
| InChIKey | MYFGEYILUHUEIA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|