C13H14ClNO2 — CID 168686794
4-chloro-1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyrrolidin-2-one (PubChem CID 168686794) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 4-chloro-1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyrrolidin-2-one.
| Compound Name | 4-chloro-1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168686794 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-chloro-1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C13H14ClNO2/c14-9-6-12(17)15(7-9)13-10-4-2-1-3-8(10)5-11(13)16/h1-4,9,11,13,16H,5-7H2/t9?,11-,13+/m0/s1 |
| InChIKey | LIOKYOLESFBFIM-DALSCRRLSA-N |
| XLogP | 1.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|